C23H29F3O8 — CID 102311244
2-O,2-O',5-O-triethyl 4-O-(2,2,2-trifluoroethyl) (3aR,4S,5S,7aR)-6,7-dimethylidene-1,3,3a,4,5,7a-hexahydroindene-2,2,4,5-tetracarboxylate (PubChem CID 102311244) has the molecular formula C23H29F3O8 and a molecular weight of 490.47 g/mol. Its IUPAC name is 2-O,2-O',5-O-triethyl 4-O-(2,2,2-trifluoroethyl) (3aR,4S,5S,7aR)-6,7-dimethylidene-1,3,3a,4,5,7a-hexahydroindene-2,2,4,5-tetracarboxylate.
| Compound Name | 2-O,2-O',5-O-triethyl 4-O-(2,2,2-trifluoroethyl) (3aR,4S,5S,7aR)-6,7-dimethylidene-1,3,3a,4,5,7a-hexahydroindene-2,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 102311244 |
| Molecular Formula | C23H29F3O8 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-O,2-O',5-O-triethyl 4-O-(2,2,2-trifluoroethyl) (3aR,4S,5S,7aR)-6,7-dimethylidene-1,3,3a,4,5,7a-hexahydroindene-2,2,4,5-tetracarboxylate |
| SMILES | C=C1C(=C)[C@@H]2CC(C(=O)OCC)(C(=O)OCC)C[C@H]2[C@H](C(=O)OCC(F)(F)F)[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C23H29F3O8/c1-6-31-18(27)16-13(5)12(4)14-9-22(20(29)32-7-2,21(30)33-8-3)10-15(14)17(16)19(28)34-11-23(24,25)26/h14-17H,4-11H2,1-3H3/t14-,15+,16+,17-/m0/s1 |
| InChIKey | HJGKSLMHZLRTHZ-HZMVEIRTSA-N |
| XLogP | 3.15 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|