C21H31O4Y- — CID 59051143
methyl 5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-2-oxooxolane-3-carboxylate;yttrium (PubChem CID 59051143) has the molecular formula C21H31O4Y- and a molecular weight of 436.38 g/mol. Its IUPAC name is methyl 5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-2-oxooxolane-3-carboxylate;yttrium.
| Compound Name | methyl 5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-2-oxooxolane-3-carboxylate;yttrium |
|---|---|
| PubChem CID | 59051143 |
| Molecular Formula | C21H31O4Y- |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | methyl 5-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-2-oxooxolane-3-carboxylate;yttrium |
| SMILES | [H]/[C-]=C1/CCC[C@@]2(C)C1CC[C@@H]2C(C)CCC1CC(C(=O)OC)C(=O)O1.[Y] |
| InChI | InChI=1S/C21H31O4.Y/c1-13-6-5-11-21(3)17(13)9-10-18(21)14(2)7-8-15-12-16(19(22)24-4)20(23)25-15;/h1,14-18H,5-12H2,2-4H3;/q-1;/t14?,15?,16?,17?,18-,21+;/m1./s1 |
| InChIKey | ZWVOUOUKXGZLKK-ZLHOUWRKSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|