C21H31O2Y- — CID 59043525
6-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-5-oxaspiro[2.4]heptan-4-one;yttrium (PubChem CID 59043525) has the molecular formula C21H31O2Y- and a molecular weight of 404.38 g/mol. Its IUPAC name is 6-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-5-oxaspiro[2.4]heptan-4-one;yttrium.
| Compound Name | 6-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-5-oxaspiro[2.4]heptan-4-one;yttrium |
|---|---|
| PubChem CID | 59043525 |
| Molecular Formula | C21H31O2Y- |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 6-[3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-5-oxaspiro[2.4]heptan-4-one;yttrium |
| SMILES | [H]/[C-]=C1/CCC[C@@]2(C)C1CC[C@@H]2C(C)CCC1CC2(CC2)C(=O)O1.[Y] |
| InChI | InChI=1S/C21H31O2.Y/c1-14-5-4-10-20(3)17(14)8-9-18(20)15(2)6-7-16-13-21(11-12-21)19(22)23-16;/h1,15-18H,4-13H2,2-3H3;/q-1;/t15?,16?,17?,18-,20+;/m1./s1 |
| InChIKey | QOWUKUZJVZLRLZ-OMBQITSXSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|