C15H23OY- — CID 59043469
(3R)-3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal;yttrium (PubChem CID 59043469) has the molecular formula C15H23OY- and a molecular weight of 308.25 g/mol. Its IUPAC name is (3R)-3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal;yttrium.
| Compound Name | (3R)-3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal;yttrium |
|---|---|
| PubChem CID | 59043469 |
| Molecular Formula | C15H23OY- |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (3R)-3-[(1R,7aR)-4-methanidylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal;yttrium |
| SMILES | [H]/[C-]=C1/CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)CC=O.[Y] |
| InChI | InChI=1S/C15H23O.Y/c1-11-5-4-9-15(3)13(11)6-7-14(15)12(2)8-10-16;/h1,10,12-14H,4-9H2,2-3H3;/q-1;/t12-,13?,14-,15+;/m1./s1 |
| InChIKey | LTTXMTVSXYLGNQ-MHTAIONASA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|