C11H6O2S — CID 134948008
thieno[3,2-c]isochromen-5-one (PubChem CID 134948008) has the molecular formula C11H6O2S and a molecular weight of 202.23 g/mol. Its IUPAC name is thieno[3,2-c]isochromen-5-one.
| Compound Name | thieno[3,2-c]isochromen-5-one |
|---|---|
| PubChem CID | 134948008 |
| Molecular Formula | C11H6O2S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | thieno[3,2-c]isochromen-5-one |
| SMILES | O=c1oc2ccsc2c2ccccc12 |
| InChI | InChI=1S/C11H6O2S/c12-11-8-4-2-1-3-7(8)10-9(13-11)5-6-14-10/h1-6H |
| InChIKey | VYFHZAGBWLIKKY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |