C13H5NO2S2 — CID 148695832
9,13-dioxa-5,17-dithia-11-azapentacyclo[10.6.0.03,10.04,8.014,18]octadeca-1(12),2,4(8),6,10,14(18),15-heptaene (PubChem CID 148695832) has the molecular formula C13H5NO2S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 9,13-dioxa-5,17-dithia-11-azapentacyclo[10.6.0.03,10.04,8.014,18]octadeca-1(12),2,4(8),6,10,14(18),15-heptaene.
| Compound Name | 9,13-dioxa-5,17-dithia-11-azapentacyclo[10.6.0.03,10.04,8.014,18]octadeca-1(12),2,4(8),6,10,14(18),15-heptaene |
|---|---|
| PubChem CID | 148695832 |
| Molecular Formula | C13H5NO2S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 9,13-dioxa-5,17-dithia-11-azapentacyclo[10.6.0.03,10.04,8.014,18]octadeca-1(12),2,4(8),6,10,14(18),15-heptaene |
| SMILES | c1cc2oc3nc4oc5ccsc5c4cc3c2s1 |
| InChI | InChI=1S/C13H5NO2S2/c1-3-17-10-6-5-7-11-9(2-4-18-11)16-13(7)14-12(6)15-8(1)10/h1-5H |
| InChIKey | NUJUEDGPFSGRGL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |