About benzyl(triphenyl)azanium bromide
benzyl(triphenyl)azanium bromide (PubChem CID 13494846) has the molecular formula C25H22BrN
and a molecular weight of 416.36 g/mol. Its IUPAC name is benzyl(triphenyl)azanium bromide.
Molecular Properties
| Compound Name | benzyl(triphenyl)azanium bromide |
| PubChem CID | 13494846 |
| Molecular Formula | C25H22BrN |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | benzyl(triphenyl)azanium bromide |
| SMILES | [Br-].c1ccc(C[N+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N.BrH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;1H/q+1;/p-1 |
| InChIKey | IVYWIMUIJFCHRM-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triphenyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triphenyl)azanium bromide?
The IUPAC name of benzyl(triphenyl)azanium bromide (CID 13494846) is benzyl(triphenyl)azanium bromide.
What is the SMILES notation for benzyl(triphenyl)azanium bromide?
The canonical SMILES for benzyl(triphenyl)azanium bromide is [Br-].c1ccc(C[N+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzyl(triphenyl)azanium bromide?
The InChIKey is IVYWIMUIJFCHRM-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H22N.BrH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h1-20H,21H2;1H/q+1;/p-1.
What are the key properties of benzyl(triphenyl)azanium bromide?
benzyl(triphenyl)azanium bromide has a molecular weight of 416.36 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triphenyl)azanium bromide is sourced from PubChem (CID 13494846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).