C23H29NO3 — CID 134949509
methyl (2S,3R)-2-(benzhydrylamino)-3-cyclohexyl-3-hydroxypropanoate (PubChem CID 134949509) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzhydrylamino)-3-cyclohexyl-3-hydroxypropanoate.
| Compound Name | methyl (2S,3R)-2-(benzhydrylamino)-3-cyclohexyl-3-hydroxypropanoate |
|---|---|
| PubChem CID | 134949509 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | methyl (2S,3R)-2-(benzhydrylamino)-3-cyclohexyl-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](NC(c1ccccc1)c1ccccc1)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C23H29NO3/c1-27-23(26)21(22(25)19-15-9-4-10-16-19)24-20(17-11-5-2-6-12-17)18-13-7-3-8-14-18/h2-3,5-8,11-14,19-22,24-25H,4,9-10,15-16H2,1H3/t21-,22+/m0/s1 |
| InChIKey | QPZJSTQIWKJGGV-FCHUYYIVSA-N |
| XLogP | 3.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |