C30H50O5Si — CID 134949591
[(1R,3S,5S,8S,10S,13S)-13-acetyloxy-8,12,15,15-tetramethyl-4-methylidene-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 134949591) has the molecular formula C30H50O5Si and a molecular weight of 518.81 g/mol. Its IUPAC name is [(1R,3S,5S,8S,10S,13S)-13-acetyloxy-8,12,15,15-tetramethyl-4-methylidene-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1R,3S,5S,8S,10S,13S)-13-acetyloxy-8,12,15,15-tetramethyl-4-methylidene-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 134949591 |
| Molecular Formula | C30H50O5Si |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | [(1R,3S,5S,8S,10S,13S)-13-acetyloxy-8,12,15,15-tetramethyl-4-methylidene-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | C=C1[C@@H](OC(C)=O)CC[C@@]2(C)C[C@H](O[Si](CC)(CC)CC)C3=C(C)[C@@H](OC(C)=O)C[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C30H50O5Si/c1-11-36(12-2,13-3)35-27-18-30(10)15-14-25(33-21(6)31)19(4)24(30)16-23-17-26(34-22(7)32)20(5)28(27)29(23,8)9/h23-27H,4,11-18H2,1-3,5-10H3/t23-,24-,25+,26+,27+,30+/m1/s1 |
| InChIKey | XGWKVLZMDBNUGE-OQDYUIEKSA-N |
| XLogP | 7.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|