C31H30O4 — CID 134949976
dibenzyl (1S,4E,5R)-4-benzylidene-5-ethylbicyclo[3.1.0]hexane-2,2-dicarboxylate (PubChem CID 134949976) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is dibenzyl (1S,4E,5R)-4-benzylidene-5-ethylbicyclo[3.1.0]hexane-2,2-dicarboxylate.
| Compound Name | dibenzyl (1S,4E,5R)-4-benzylidene-5-ethylbicyclo[3.1.0]hexane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134949976 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | dibenzyl (1S,4E,5R)-4-benzylidene-5-ethylbicyclo[3.1.0]hexane-2,2-dicarboxylate |
| SMILES | CC[C@@]12C[C@@H]1C(C(=O)OCc1ccccc1)(C(=O)OCc1ccccc1)C/C2=C\c1ccccc1 |
| InChI | InChI=1S/C31H30O4/c1-2-30-20-27(30)31(19-26(30)18-23-12-6-3-7-13-23,28(32)34-21-24-14-8-4-9-15-24)29(33)35-22-25-16-10-5-11-17-25/h3-18,27H,2,19-22H2,1H3/b26-18+/t27-,30-/m0/s1 |
| InChIKey | YHXMVPNCVZLCPH-SGYXBDPBSA-N |
| XLogP | 6.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|