C19H17NO3 — CID 134951334
(4S)-4-(3-oxobutyl)-3,4-diphenyl-1,2-oxazol-5-one (PubChem CID 134951334) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (4S)-4-(3-oxobutyl)-3,4-diphenyl-1,2-oxazol-5-one.
| Compound Name | (4S)-4-(3-oxobutyl)-3,4-diphenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 134951334 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (4S)-4-(3-oxobutyl)-3,4-diphenyl-1,2-oxazol-5-one |
| SMILES | CC(=O)CC[C@@]1(c2ccccc2)C(=O)ON=C1c1ccccc1 |
| InChI | InChI=1S/C19H17NO3/c1-14(21)12-13-19(16-10-6-3-7-11-16)17(20-23-18(19)22)15-8-4-2-5-9-15/h2-11H,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | WQMXKUFLYMZOCH-IBGZPJMESA-N |
| XLogP | 3.25 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|