C13H13NO2 — CID 102228138
3-methyl-4-phenyl-4-prop-2-enyl-1,2-oxazol-5-one (PubChem CID 102228138) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-methyl-4-phenyl-4-prop-2-enyl-1,2-oxazol-5-one.
| Compound Name | 3-methyl-4-phenyl-4-prop-2-enyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 102228138 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-methyl-4-phenyl-4-prop-2-enyl-1,2-oxazol-5-one |
| SMILES | C=CCC1(c2ccccc2)C(=O)ON=C1C |
| InChI | InChI=1S/C13H13NO2/c1-3-9-13(10(2)14-16-12(13)15)11-7-5-4-6-8-11/h3-8H,1,9H2,2H3 |
| InChIKey | BNJVUTLEUNXNLN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|