C20H26O2 — CID 10566011
2-butan-2-yl-4-phenyl-3-propan-2-yloxy-4-prop-2-enylcyclobut-2-en-1-one (PubChem CID 10566011) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-butan-2-yl-4-phenyl-3-propan-2-yloxy-4-prop-2-enylcyclobut-2-en-1-one.
| Compound Name | 2-butan-2-yl-4-phenyl-3-propan-2-yloxy-4-prop-2-enylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10566011 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-butan-2-yl-4-phenyl-3-propan-2-yloxy-4-prop-2-enylcyclobut-2-en-1-one |
| SMILES | C=CCC1(c2ccccc2)C(=O)C(C(C)CC)=C1OC(C)C |
| InChI | InChI=1S/C20H26O2/c1-6-13-20(16-11-9-8-10-12-16)18(21)17(15(5)7-2)19(20)22-14(3)4/h6,8-12,14-15H,1,7,13H2,2-5H3 |
| InChIKey | QFNDKUQREDDCOB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|