C20H26O4 — CID 10568430
2-butyl-4-hydroperoxy-3-propan-2-yloxy-4-prop-2-enylnaphthalen-1-one (PubChem CID 10568430) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-butyl-4-hydroperoxy-3-propan-2-yloxy-4-prop-2-enylnaphthalen-1-one.
| Compound Name | 2-butyl-4-hydroperoxy-3-propan-2-yloxy-4-prop-2-enylnaphthalen-1-one |
|---|---|
| PubChem CID | 10568430 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-butyl-4-hydroperoxy-3-propan-2-yloxy-4-prop-2-enylnaphthalen-1-one |
| SMILES | C=CCC1(OO)C(OC(C)C)=C(CCCC)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H26O4/c1-5-7-10-16-18(21)15-11-8-9-12-17(15)20(24-22,13-6-2)19(16)23-14(3)4/h6,8-9,11-12,14,22H,2,5,7,10,13H2,1,3-4H3 |
| InChIKey | DPSKZXPLJHGBSL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|