C25H36O5 — CID 134951687
ethyl (3S,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,9,12b-pentamethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-10-carboxylate (PubChem CID 134951687) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is ethyl (3S,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,9,12b-pentamethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-10-carboxylate.
| Compound Name | ethyl (3S,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,9,12b-pentamethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-10-carboxylate |
|---|---|
| PubChem CID | 134951687 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | ethyl (3S,4aR,6aR,12aR,12bS)-3,11-dihydroxy-4,4,6a,9,12b-pentamethyl-1,2,3,4a,5,6,12,12a-octahydrobenzo[a]xanthene-10-carboxylate |
| SMILES | CCOC(=O)c1c(C)cc2c(c1O)C[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3CC[C@@]1(C)O2 |
| InChI | InChI=1S/C25H36O5/c1-7-29-22(28)20-14(2)12-16-15(21(20)27)13-18-24(5)10-9-19(26)23(3,4)17(24)8-11-25(18,6)30-16/h12,17-19,26-27H,7-11,13H2,1-6H3/t17-,18+,19-,24-,25+/m0/s1 |
| InChIKey | OFRBWOJYVRYKOC-KSDLHCFASA-N |
| XLogP | 4.78 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |