C20H19NO3S — CID 134953311
9-[2-(4-methoxyphenyl)ethynyl]-11-methylsulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 134953311) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 9-[2-(4-methoxyphenyl)ethynyl]-11-methylsulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | 9-[2-(4-methoxyphenyl)ethynyl]-11-methylsulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 134953311 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 9-[2-(4-methoxyphenyl)ethynyl]-11-methylsulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | COc1ccc(C#CC2CC3c4ccccc4C2N3S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H19NO3S/c1-24-16-11-8-14(9-12-16)7-10-15-13-19-17-5-3-4-6-18(17)20(15)21(19)25(2,22)23/h3-6,8-9,11-12,15,19-20H,13H2,1-2H3 |
| InChIKey | KGSCZAYGKYHRLY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|