C19H14Br2O2 — CID 102450117
(9S)-4,5-dibromo-9-[2-(4-methoxyphenyl)ethynyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 102450117) has the molecular formula C19H14Br2O2 and a molecular weight of 434.13 g/mol. Its IUPAC name is (9S)-4,5-dibromo-9-[2-(4-methoxyphenyl)ethynyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (9S)-4,5-dibromo-9-[2-(4-methoxyphenyl)ethynyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 102450117 |
| Molecular Formula | C19H14Br2O2 |
| Molecular Weight | 434.13 g/mol |
| Exact Mass | 431.94 |
| IUPAC Name | (9S)-4,5-dibromo-9-[2-(4-methoxyphenyl)ethynyl]-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | COc1ccc(C#C[C@@H]2CC3OC2c2cc(Br)c(Br)cc23)cc1 |
| InChI | InChI=1S/C19H14Br2O2/c1-22-13-6-3-11(4-7-13)2-5-12-8-18-14-9-16(20)17(21)10-15(14)19(12)23-18/h3-4,6-7,9-10,12,18-19H,8H2,1H3/t12-,18?,19?/m1/s1 |
| InChIKey | RTJUXJDWEPQAFH-PIHIASKNSA-N |
| XLogP | 5.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.13 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|