C25H27NO3 — CID 134954383
(7R,7aS,10aS)-9-tert-butyl-7-hydroxy-7-phenyl-1,2,3,7a,10a,10b-hexahydrophenaleno[1,2-c]pyrrole-8,10-dione (PubChem CID 134954383) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (7R,7aS,10aS)-9-tert-butyl-7-hydroxy-7-phenyl-1,2,3,7a,10a,10b-hexahydrophenaleno[1,2-c]pyrrole-8,10-dione.
| Compound Name | (7R,7aS,10aS)-9-tert-butyl-7-hydroxy-7-phenyl-1,2,3,7a,10a,10b-hexahydrophenaleno[1,2-c]pyrrole-8,10-dione |
|---|---|
| PubChem CID | 134954383 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (7R,7aS,10aS)-9-tert-butyl-7-hydroxy-7-phenyl-1,2,3,7a,10a,10b-hexahydrophenaleno[1,2-c]pyrrole-8,10-dione |
| SMILES | CC(C)(C)N1C(=O)[C@H]2C3CCCc4cccc(c43)[C@](O)(c3ccccc3)[C@H]2C1=O |
| InChI | InChI=1S/C25H27NO3/c1-24(2,3)26-22(27)20-17-13-7-9-15-10-8-14-18(19(15)17)25(29,21(20)23(26)28)16-11-5-4-6-12-16/h4-6,8,10-12,14,17,20-21,29H,7,9,13H2,1-3H3/t17?,20-,21+,25+/m0/s1 |
| InChIKey | YPOPRANUAUTYGP-COXPAHOASA-N |
| XLogP | 3.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|