C25H28N2O2 — CID 134955312
tert-butyl (2'S)-4'-ethenyl-2'-(4-methylphenyl)spiro[indole-3,3'-pyrrolidine]-1'-carboxylate (PubChem CID 134955312) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl (2'S)-4'-ethenyl-2'-(4-methylphenyl)spiro[indole-3,3'-pyrrolidine]-1'-carboxylate.
| Compound Name | tert-butyl (2'S)-4'-ethenyl-2'-(4-methylphenyl)spiro[indole-3,3'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 134955312 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | tert-butyl (2'S)-4'-ethenyl-2'-(4-methylphenyl)spiro[indole-3,3'-pyrrolidine]-1'-carboxylate |
| SMILES | C=CC1CN(C(=O)OC(C)(C)C)[C@@H](c2ccc(C)cc2)C12C=Nc1ccccc12 |
| InChI | InChI=1S/C25H28N2O2/c1-6-19-15-27(23(28)29-24(3,4)5)22(18-13-11-17(2)12-14-18)25(19)16-26-21-10-8-7-9-20(21)25/h6-14,16,19,22H,1,15H2,2-5H3/t19?,22-,25?/m0/s1 |
| InChIKey | ZJJLZEALRXUMQF-WQNVSQMQSA-N |
| XLogP | 5.74 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|