C12H14O — CID 134955528
(2S,3S)-3-methyl-2-(4-methylphenyl)-2,3-dihydrofuran (PubChem CID 134955528) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(4-methylphenyl)-2,3-dihydrofuran.
| Compound Name | (2S,3S)-3-methyl-2-(4-methylphenyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 134955528 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2S,3S)-3-methyl-2-(4-methylphenyl)-2,3-dihydrofuran |
| SMILES | Cc1ccc([C@H]2OC=C[C@@H]2C)cc1 |
| InChI | InChI=1S/C12H14O/c1-9-3-5-11(6-4-9)12-10(2)7-8-13-12/h3-8,10,12H,1-2H3/t10-,12-/m0/s1 |
| InChIKey | NVYZPPUQQXMUKY-JQWIXIFHSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |