C28H27NO3 — CID 134955776
2'-butyl-4',6'-dimethoxy-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one (PubChem CID 134955776) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2'-butyl-4',6'-dimethoxy-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one.
| Compound Name | 2'-butyl-4',6'-dimethoxy-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one |
|---|---|
| PubChem CID | 134955776 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2'-butyl-4',6'-dimethoxy-3'-phenylspiro[2H-isoindole-3,1'-indene]-1-one |
| SMILES | CCCCC1=C(c2ccccc2)c2c(OC)cc(OC)cc2C12NC(=O)c1ccccc12 |
| InChI | InChI=1S/C28H27NO3/c1-4-5-14-22-25(18-11-7-6-8-12-18)26-23(16-19(31-2)17-24(26)32-3)28(22)21-15-10-9-13-20(21)27(30)29-28/h6-13,15-17H,4-5,14H2,1-3H3,(H,29,30) |
| InChIKey | XCAPEWOINKSVBF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |