C24H22O2 — CID 134955933
(3R)-7-methyl-7'-phenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol (PubChem CID 134955933) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3R)-7-methyl-7'-phenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol.
| Compound Name | (3R)-7-methyl-7'-phenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
|---|---|
| PubChem CID | 134955933 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (3R)-7-methyl-7'-phenyl-3,3'-spirobi[1,2-dihydroindene]-4,4'-diol |
| SMILES | Cc1ccc(O)c2c1CC[C@@]21CCc2c(-c3ccccc3)ccc(O)c21 |
| InChI | InChI=1S/C24H22O2/c1-15-7-9-20(25)22-17(15)11-13-24(22)14-12-19-18(8-10-21(26)23(19)24)16-5-3-2-4-6-16/h2-10,25-26H,11-14H2,1H3/t24-/m1/s1 |
| InChIKey | YZTRXBPKHKZAFB-XMMPIXPASA-N |
| XLogP | 5.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |