C17H31NO2 — CID 134956061
[(E)-3,7-dimethyl-6-piperidin-1-yloct-2-enyl] acetate (PubChem CID 134956061) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is [(E)-3,7-dimethyl-6-piperidin-1-yloct-2-enyl] acetate.
| Compound Name | [(E)-3,7-dimethyl-6-piperidin-1-yloct-2-enyl] acetate |
|---|---|
| PubChem CID | 134956061 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | [(E)-3,7-dimethyl-6-piperidin-1-yloct-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CCC(C(C)C)N1CCCCC1 |
| InChI | InChI=1S/C17H31NO2/c1-14(2)17(18-11-6-5-7-12-18)9-8-15(3)10-13-20-16(4)19/h10,14,17H,5-9,11-13H2,1-4H3/b15-10+ |
| InChIKey | OQENQYVGILKRJC-XNTDXEJSSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|