C16H27NO2 — CID 139927023
ethenyl (E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate (PubChem CID 139927023) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is ethenyl (E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate.
| Compound Name | ethenyl (E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 139927023 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | ethenyl (E)-2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-enoate |
| SMILES | C=COC(=O)/C(C)=C/C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C16H27NO2/c1-8-19-14(18)12(2)9-13-10-15(3,4)17(7)16(5,6)11-13/h8-9,13H,1,10-11H2,2-7H3/b12-9+ |
| InChIKey | VPAWDZIKYYDACB-FMIVXFBMSA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|