C11H19NO2 — CID 123139021
ethyl 2-(1,2-dimethylpiperidin-4-ylidene)acetate (PubChem CID 123139021) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is ethyl 2-(1,2-dimethylpiperidin-4-ylidene)acetate.
| Compound Name | ethyl 2-(1,2-dimethylpiperidin-4-ylidene)acetate |
|---|---|
| PubChem CID | 123139021 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | ethyl 2-(1,2-dimethylpiperidin-4-ylidene)acetate |
| SMILES | CCOC(=O)C=C1CCN(C)C(C)C1 |
| InChI | InChI=1S/C11H19NO2/c1-4-14-11(13)8-10-5-6-12(3)9(2)7-10/h8-9H,4-7H2,1-3H3 |
| InChIKey | NARIDMNUFFWXSJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|