C12H16O4 — CID 134957625
3-(2-methyl-3-oxobutan-2-yl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione (PubChem CID 134957625) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(2-methyl-3-oxobutan-2-yl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2-methyl-3-oxobutan-2-yl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 134957625 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-(2-methyl-3-oxobutan-2-yl)-4-propan-2-yloxycyclobut-3-ene-1,2-dione |
| SMILES | CC(=O)C(C)(C)c1c(OC(C)C)c(=O)c1=O |
| InChI | InChI=1S/C12H16O4/c1-6(2)16-11-8(9(14)10(11)15)12(4,5)7(3)13/h6H,1-5H3 |
| InChIKey | PBCIEZXNUIVZGU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|