C16H26O3 — CID 21058204
3-propan-2-yloxy-4-(2,2,4,4-tetramethylpentan-3-yl)cyclobut-3-ene-1,2-dione (PubChem CID 21058204) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-propan-2-yloxy-4-(2,2,4,4-tetramethylpentan-3-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-propan-2-yloxy-4-(2,2,4,4-tetramethylpentan-3-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 21058204 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 3-propan-2-yloxy-4-(2,2,4,4-tetramethylpentan-3-yl)cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)Oc1c(C(C(C)(C)C)C(C)(C)C)c(=O)c1=O |
| InChI | InChI=1S/C16H26O3/c1-9(2)19-13-10(11(17)12(13)18)14(15(3,4)5)16(6,7)8/h9,14H,1-8H3 |
| InChIKey | IXWZZDSZKLOJBO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|