C29H48N2O4Sn — CID 134959041
tert-butyl 3-(2-formamidoethyl)-6-methoxy-2-tributylstannylindole-1-carboxylate (PubChem CID 134959041) has the molecular formula C29H48N2O4Sn and a molecular weight of 607.42 g/mol. Its IUPAC name is tert-butyl 3-(2-formamidoethyl)-6-methoxy-2-tributylstannylindole-1-carboxylate.
| Compound Name | tert-butyl 3-(2-formamidoethyl)-6-methoxy-2-tributylstannylindole-1-carboxylate |
|---|---|
| PubChem CID | 134959041 |
| Molecular Formula | C29H48N2O4Sn |
| Molecular Weight | 607.42 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | tert-butyl 3-(2-formamidoethyl)-6-methoxy-2-tributylstannylindole-1-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1c(CCNC=O)c2ccc(OC)cc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21N2O4.3C4H9.Sn/c1-17(2,3)23-16(21)19-10-12(7-8-18-11-20)14-6-5-13(22-4)9-15(14)19;3*1-3-4-2;/h5-6,9,11H,7-8H2,1-4H3,(H,18,20);3*1,3-4H2,2H3; |
| InChIKey | WKEVCGHRFTZPHH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|