C13H15NO5 — CID 102142630
tert-butyl 5-methoxy-3-oxo-2,1-benzoxazole-1-carboxylate (PubChem CID 102142630) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is tert-butyl 5-methoxy-3-oxo-2,1-benzoxazole-1-carboxylate.
| Compound Name | tert-butyl 5-methoxy-3-oxo-2,1-benzoxazole-1-carboxylate |
|---|---|
| PubChem CID | 102142630 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | tert-butyl 5-methoxy-3-oxo-2,1-benzoxazole-1-carboxylate |
| SMILES | COc1ccc2c(c1)c(=O)on2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H15NO5/c1-13(2,3)18-12(16)14-10-6-5-8(17-4)7-9(10)11(15)19-14/h5-7H,1-4H3 |
| InChIKey | SKZPLOMCAVZPDY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |