C24H36N2O6Si — CID 134959101
(4R)-3-[(Z,5S)-6-methyl-5-(nitromethyl)-2-triethylsilyloxyhept-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 134959101) has the molecular formula C24H36N2O6Si and a molecular weight of 476.65 g/mol. Its IUPAC name is (4R)-3-[(Z,5S)-6-methyl-5-(nitromethyl)-2-triethylsilyloxyhept-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(Z,5S)-6-methyl-5-(nitromethyl)-2-triethylsilyloxyhept-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134959101 |
| Molecular Formula | C24H36N2O6Si |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (4R)-3-[(Z,5S)-6-methyl-5-(nitromethyl)-2-triethylsilyloxyhept-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[Si](CC)(CC)O/C(=C\C[C@H](C[N+](=O)[O-])C(C)C)C(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H36N2O6Si/c1-6-33(7-2,8-3)32-22(15-14-20(18(4)5)16-25(29)30)23(27)26-21(17-31-24(26)28)19-12-10-9-11-13-19/h9-13,15,18,20-21H,6-8,14,16-17H2,1-5H3/b22-15-/t20-,21+/m1/s1 |
| InChIKey | RSGZDYQKFCAUMG-LPJDDIMUSA-N |
| XLogP | 5.55 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|