C19H17NO — CID 134960311
(8R)-8-naphthalen-1-yl-6,7,8,9-tetrahydroquinolizin-2-one (PubChem CID 134960311) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is (8R)-8-naphthalen-1-yl-6,7,8,9-tetrahydroquinolizin-2-one.
| Compound Name | (8R)-8-naphthalen-1-yl-6,7,8,9-tetrahydroquinolizin-2-one |
|---|---|
| PubChem CID | 134960311 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (8R)-8-naphthalen-1-yl-6,7,8,9-tetrahydroquinolizin-2-one |
| SMILES | O=c1ccn2c(c1)C[C@H](c1cccc3ccccc13)CC2 |
| InChI | InChI=1S/C19H17NO/c21-17-9-11-20-10-8-15(12-16(20)13-17)19-7-3-5-14-4-1-2-6-18(14)19/h1-7,9,11,13,15H,8,10,12H2/t15-/m1/s1 |
| InChIKey | NMGHTBIWIIVBJT-OAHLLOKOSA-N |
| XLogP | 3.73 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |