C14H13NO — CID 134960516
(1S)-1-ethenyl-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one (PubChem CID 134960516) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is (1S)-1-ethenyl-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one.
| Compound Name | (1S)-1-ethenyl-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one |
|---|---|
| PubChem CID | 134960516 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (1S)-1-ethenyl-2,3-dihydro-1H-pyrrolo[1,2-a]quinolin-8-one |
| SMILES | C=C[C@@H]1CCc2ccc3ccc(=O)cc-3n21 |
| InChI | InChI=1S/C14H13NO/c1-2-11-6-7-12-5-3-10-4-8-13(16)9-14(10)15(11)12/h2-5,8-9,11H,1,6-7H2/t11-/m1/s1 |
| InChIKey | KQXDZMUFYRGDIA-LLVKDONJSA-N |
| XLogP | 2.63 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|