C20H17N5O2 — CID 134960549
(4-nitrophenyl)-(2-pyridin-2-yl-1,2,3,4-tetrahydroquinolin-6-yl)diazene (PubChem CID 134960549) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is (4-nitrophenyl)-(2-pyridin-2-yl-1,2,3,4-tetrahydroquinolin-6-yl)diazene.
| Compound Name | (4-nitrophenyl)-(2-pyridin-2-yl-1,2,3,4-tetrahydroquinolin-6-yl)diazene |
|---|---|
| PubChem CID | 134960549 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (4-nitrophenyl)-(2-pyridin-2-yl-1,2,3,4-tetrahydroquinolin-6-yl)diazene |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2ccc3c(c2)CCC(c2ccccn2)N3)cc1 |
| InChI | InChI=1S/C20H17N5O2/c26-25(27)17-8-5-15(6-9-17)23-24-16-7-11-18-14(13-16)4-10-20(22-18)19-3-1-2-12-21-19/h1-3,5-9,11-13,20,22H,4,10H2/b24-23+ |
| InChIKey | ONRJKYQJNMCLBS-WCWDXBQESA-N |
| XLogP | 5.50 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|