About (4S)-3,3-dimethyl-4-phenyloxane
(4S)-3,3-dimethyl-4-phenyloxane (PubChem CID 134961024) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is (4S)-3,3-dimethyl-4-phenyloxane.
Molecular Properties
| Compound Name | (4S)-3,3-dimethyl-4-phenyloxane |
| PubChem CID | 134961024 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (4S)-3,3-dimethyl-4-phenyloxane |
| SMILES | CC1(C)COCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H18O/c1-13(2)10-14-9-8-12(13)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | GDGFJRXMWORCCM-LBPRGKRZSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-3,3-dimethyl-4-phenyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,3-dimethyl-4-phenyloxane?
The IUPAC name of (4S)-3,3-dimethyl-4-phenyloxane (CID 134961024) is (4S)-3,3-dimethyl-4-phenyloxane.
What is the SMILES notation for (4S)-3,3-dimethyl-4-phenyloxane?
The canonical SMILES for (4S)-3,3-dimethyl-4-phenyloxane is CC1(C)COCC[C@H]1c1ccccc1.
What is the InChIKey of (4S)-3,3-dimethyl-4-phenyloxane?
The InChIKey is GDGFJRXMWORCCM-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H18O/c1-13(2)10-14-9-8-12(13)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/t12-/m0/s1.
What are the key properties of (4S)-3,3-dimethyl-4-phenyloxane?
(4S)-3,3-dimethyl-4-phenyloxane has a molecular weight of 190.29 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,3-dimethyl-4-phenyloxane is sourced from PubChem (CID 134961024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).