C13H18O — CID 134961024
(4S)-3,3-dimethyl-4-phenyloxane (PubChem CID 134961024) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (4S)-3,3-dimethyl-4-phenyloxane.
| Compound Name | (4S)-3,3-dimethyl-4-phenyloxane |
|---|---|
| PubChem CID | 134961024 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (4S)-3,3-dimethyl-4-phenyloxane |
| SMILES | CC1(C)COCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H18O/c1-13(2)10-14-9-8-12(13)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | GDGFJRXMWORCCM-LBPRGKRZSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |