C18H14F3NO3S — CID 134961500
1-(4-methylphenyl)sulfonyl-5-[(2S)-2-(trifluoromethyl)oxiran-2-yl]indole (PubChem CID 134961500) has the molecular formula C18H14F3NO3S and a molecular weight of 381.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-5-[(2S)-2-(trifluoromethyl)oxiran-2-yl]indole.
| Compound Name | 1-(4-methylphenyl)sulfonyl-5-[(2S)-2-(trifluoromethyl)oxiran-2-yl]indole |
|---|---|
| PubChem CID | 134961500 |
| Molecular Formula | C18H14F3NO3S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-5-[(2S)-2-(trifluoromethyl)oxiran-2-yl]indole |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3cc([C@@]4(C(F)(F)F)CO4)ccc32)cc1 |
| InChI | InChI=1S/C18H14F3NO3S/c1-12-2-5-15(6-3-12)26(23,24)22-9-8-13-10-14(4-7-16(13)22)17(11-25-17)18(19,20)21/h2-10H,11H2,1H3/t17-/m1/s1 |
| InChIKey | DEURQCFDIKTMRV-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 51.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|