C18H13F4NO4S — CID 15584728
[4,5,6,7-tetrafluoro-1-(4-methylphenyl)sulfonylindol-3-yl]methyl acetate (PubChem CID 15584728) has the molecular formula C18H13F4NO4S and a molecular weight of 415.36 g/mol. Its IUPAC name is [4,5,6,7-tetrafluoro-1-(4-methylphenyl)sulfonylindol-3-yl]methyl acetate.
| Compound Name | [4,5,6,7-tetrafluoro-1-(4-methylphenyl)sulfonylindol-3-yl]methyl acetate |
|---|---|
| PubChem CID | 15584728 |
| Molecular Formula | C18H13F4NO4S |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [4,5,6,7-tetrafluoro-1-(4-methylphenyl)sulfonylindol-3-yl]methyl acetate |
| SMILES | CC(=O)OCc1cn(S(=O)(=O)c2ccc(C)cc2)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C18H13F4NO4S/c1-9-3-5-12(6-4-9)28(25,26)23-7-11(8-27-10(2)24)13-14(19)15(20)16(21)17(22)18(13)23/h3-7H,8H2,1-2H3 |
| InChIKey | WCJXUDOIKHBDCE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|