C18H24O4 — CID 134962154
(1R,4R,5S,6S,7R,10S,11S)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-5-carbaldehyde (PubChem CID 134962154) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1R,4R,5S,6S,7R,10S,11S)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-5-carbaldehyde.
| Compound Name | (1R,4R,5S,6S,7R,10S,11S)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-5-carbaldehyde |
|---|---|
| PubChem CID | 134962154 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (1R,4R,5S,6S,7R,10S,11S)-7-methyl-3,8-dioxo-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-5-carbaldehyde |
| SMILES | C/C=C/[C@H]1[C@H](C=O)[C@@H]2C(=O)O[C@H]3[C@@H]2[C@]1(C)C(=O)C[C@H]3C(C)C |
| InChI | InChI=1S/C18H24O4/c1-5-6-12-11(8-19)14-15-16(22-17(14)21)10(9(2)3)7-13(20)18(12,15)4/h5-6,8-12,14-16H,7H2,1-4H3/b6-5+/t10-,11-,12-,14-,15+,16+,18-/m0/s1 |
| InChIKey | ZZAURFZOYYLUQD-OYGMNIFMSA-N |
| XLogP | 2.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|