C23H32O4 — CID 134962208
(1R,4R,5S,6S,7R,10S,11S)-7-methyl-5-(3-methylpent-4-enoyl)-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione (PubChem CID 134962208) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1R,4R,5S,6S,7R,10S,11S)-7-methyl-5-(3-methylpent-4-enoyl)-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione.
| Compound Name | (1R,4R,5S,6S,7R,10S,11S)-7-methyl-5-(3-methylpent-4-enoyl)-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione |
|---|---|
| PubChem CID | 134962208 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1R,4R,5S,6S,7R,10S,11S)-7-methyl-5-(3-methylpent-4-enoyl)-10-propan-2-yl-6-[(E)-prop-1-enyl]-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione |
| SMILES | C=CC(C)CC(=O)[C@@H]1[C@@H]2C(=O)O[C@H]3[C@@H]2[C@](C)(C(=O)C[C@H]3C(C)C)[C@H]1/C=C/C |
| InChI | InChI=1S/C23H32O4/c1-7-9-15-18(16(24)10-13(5)8-2)19-20-21(27-22(19)26)14(12(3)4)11-17(25)23(15,20)6/h7-9,12-15,18-21H,2,10-11H2,1,3-6H3/b9-7+/t13?,14-,15-,18+,19-,20+,21+,23-/m0/s1 |
| InChIKey | PYONGQBLHWNZOC-BLSILKOBSA-N |
| XLogP | 4.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|