C20H33BrO5Si — CID 134962740
dimethyl (3Z)-3-[1-bromo-3-[tert-butyl(dimethyl)silyl]oxypropylidene]-4-ethenylcyclopentane-1,1-dicarboxylate (PubChem CID 134962740) has the molecular formula C20H33BrO5Si and a molecular weight of 461.47 g/mol. Its IUPAC name is dimethyl (3Z)-3-[1-bromo-3-[tert-butyl(dimethyl)silyl]oxypropylidene]-4-ethenylcyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3Z)-3-[1-bromo-3-[tert-butyl(dimethyl)silyl]oxypropylidene]-4-ethenylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134962740 |
| Molecular Formula | C20H33BrO5Si |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | dimethyl (3Z)-3-[1-bromo-3-[tert-butyl(dimethyl)silyl]oxypropylidene]-4-ethenylcyclopentane-1,1-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OC)(C(=O)OC)C/C1=C(/Br)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33BrO5Si/c1-9-14-12-20(17(22)24-5,18(23)25-6)13-15(14)16(21)10-11-26-27(7,8)19(2,3)4/h9,14H,1,10-13H2,2-8H3/b16-15- |
| InChIKey | ZTSKQHGDJOWOFV-NXVVXOECSA-N |
| XLogP | 4.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|