C28H40Br2O8 — CID 159871931
diethyl 2-[(E)-4-bromobut-2-enyl]-2-(2-bromoprop-2-enyl)propanedioate;diethyl 3-ethenyl-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 159871931) has the molecular formula C28H40Br2O8 and a molecular weight of 664.43 g/mol. Its IUPAC name is diethyl 2-[(E)-4-bromobut-2-enyl]-2-(2-bromoprop-2-enyl)propanedioate;diethyl 3-ethenyl-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 2-[(E)-4-bromobut-2-enyl]-2-(2-bromoprop-2-enyl)propanedioate;diethyl 3-ethenyl-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 159871931 |
| Molecular Formula | C28H40Br2O8 |
| Molecular Weight | 664.43 g/mol |
| Exact Mass | 662.11 |
| IUPAC Name | diethyl 2-[(E)-4-bromobut-2-enyl]-2-(2-bromoprop-2-enyl)propanedioate;diethyl 3-ethenyl-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C(Br)CC(C/C=C/CBr)(C(=O)OCC)C(=O)OCC.C=CC1CC(C(=O)OCC)(C(=O)OCC)CC1=C |
| InChI | InChI=1S/C14H20Br2O4.C14H20O4/c1-4-19-12(17)14(10-11(3)16,8-6-7-9-15)13(18)20-5-2;1-5-11-9-14(8-10(11)4,12(15)17-6-2)13(16)18-7-3/h6-7H,3-5,8-10H2,1-2H3;5,11H,1,4,6-9H2,2-3H3/b7-6+; |
| InChIKey | NSLQNRQTMLVIMG-UHDJGPCESA-N |
| XLogP | 5.99 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|