C10H18O3 — CID 134964276
2-[(E,4S)-4-ethoxypent-1-enyl]-1,3-dioxolane (PubChem CID 134964276) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[(E,4S)-4-ethoxypent-1-enyl]-1,3-dioxolane.
| Compound Name | 2-[(E,4S)-4-ethoxypent-1-enyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 134964276 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-[(E,4S)-4-ethoxypent-1-enyl]-1,3-dioxolane |
| SMILES | CCO[C@@H](C)C/C=C/C1OCCO1 |
| InChI | InChI=1S/C10H18O3/c1-3-11-9(2)5-4-6-10-12-7-8-13-10/h4,6,9-10H,3,5,7-8H2,1-2H3/b6-4+/t9-/m0/s1 |
| InChIKey | QLVGUYLAUPIAPB-DNQSNQRASA-N |
| XLogP | 1.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|