C16H28O3 — CID 14449806
2-cyclohexyl-3-[(E)-4,4-diethoxybut-1-enyl]oxirane (PubChem CID 14449806) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-cyclohexyl-3-[(E)-4,4-diethoxybut-1-enyl]oxirane.
| Compound Name | 2-cyclohexyl-3-[(E)-4,4-diethoxybut-1-enyl]oxirane |
|---|---|
| PubChem CID | 14449806 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-cyclohexyl-3-[(E)-4,4-diethoxybut-1-enyl]oxirane |
| SMILES | CCOC(C/C=C/C1OC1C1CCCCC1)OCC |
| InChI | InChI=1S/C16H28O3/c1-3-17-15(18-4-2)12-8-11-14-16(19-14)13-9-6-5-7-10-13/h8,11,13-16H,3-7,9-10,12H2,1-2H3/b11-8+ |
| InChIKey | IOKWNJJSOWUDPL-DHZHZOJOSA-N |
| XLogP | 3.68 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|