C10H20N2 — CID 134964888
(4R,5R)-2,7-dimethylocta-1,7-diene-4,5-diamine (PubChem CID 134964888) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (4R,5R)-2,7-dimethylocta-1,7-diene-4,5-diamine.
| Compound Name | (4R,5R)-2,7-dimethylocta-1,7-diene-4,5-diamine |
|---|---|
| PubChem CID | 134964888 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (4R,5R)-2,7-dimethylocta-1,7-diene-4,5-diamine |
| SMILES | C=C(C)C[C@@H](N)[C@H](N)CC(=C)C |
| InChI | InChI=1S/C10H20N2/c1-7(2)5-9(11)10(12)6-8(3)4/h9-10H,1,3,5-6,11-12H2,2,4H3/t9-,10-/m1/s1 |
| InChIKey | QIKKDALPRDHATR-NXEZZACHSA-N |
| XLogP | 1.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|