C13H17O8P — CID 13496748
trimethyl 1,1-dimethoxy-1lambda5-phosphacyclohexa-1,3,5-triene-2,3,6-tricarboxylate (PubChem CID 13496748) has the molecular formula C13H17O8P and a molecular weight of 332.25 g/mol. Its IUPAC name is trimethyl 1,1-dimethoxy-1lambda5-phosphacyclohexa-1,3,5-triene-2,3,6-tricarboxylate.
| Compound Name | trimethyl 1,1-dimethoxy-1lambda5-phosphacyclohexa-1,3,5-triene-2,3,6-tricarboxylate |
|---|---|
| PubChem CID | 13496748 |
| Molecular Formula | C13H17O8P |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | trimethyl 1,1-dimethoxy-1lambda5-phosphacyclohexa-1,3,5-triene-2,3,6-tricarboxylate |
| SMILES | COC(=O)C1=CC=C(C(=O)OC)P(OC)(OC)=C1C(=O)OC |
| InChI | InChI=1S/C13H17O8P/c1-17-11(14)8-6-7-9(12(15)18-2)22(20-4,21-5)10(8)13(16)19-3/h6-7H,1-5H3 |
| InChIKey | BYRWYENVRMZETQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|