About 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene
1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene (PubChem CID 134969147) has the molecular formula C24H26O4
and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene.
Molecular Properties
| Compound Name | 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene |
| PubChem CID | 134969147 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene |
| SMILES | CCOc1cc2ccccc2c(/C(OC)=C(\OC)c2ccccc2)c1OCC |
| InChI | InChI=1S/C24H26O4/c1-5-27-20-16-18-14-10-11-15-19(18)21(23(20)28-6-2)24(26-4)22(25-3)17-12-8-7-9-13-17/h7-16H,5-6H2,1-4H3/b24-22+ |
| InChIKey | WQMHGVBGBVUPFZ-ZNTNEXAZSA-N |
| XLogP | 5.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene?
The IUPAC name of 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene (CID 134969147) is 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene.
What is the SMILES notation for 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene?
The canonical SMILES for 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene is CCOc1cc2ccccc2c(/C(OC)=C(\OC)c2ccccc2)c1OCC.
What is the InChIKey of 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene?
The InChIKey is WQMHGVBGBVUPFZ-ZNTNEXAZSA-N. The full InChI is InChI=1S/C24H26O4/c1-5-27-20-16-18-14-10-11-15-19(18)21(23(20)28-6-2)24(26-4)22(25-3)17-12-8-7-9-13-17/h7-16H,5-6H2,1-4H3/b24-22+.
What are the key properties of 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene?
1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene has a molecular weight of 378.47 g/mol, XLogP of 5.76, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-1,2-dimethoxy-2-phenylethenyl]-2,3-diethoxynaphthalene is sourced from PubChem (CID 134969147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).