C4H5NOS2 — CID 134969319
2-[(S)-methylsulfinyl]-1,3-thiazole (PubChem CID 134969319) has the molecular formula C4H5NOS2 and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-[(S)-methylsulfinyl]-1,3-thiazole.
| Compound Name | 2-[(S)-methylsulfinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 134969319 |
| Molecular Formula | C4H5NOS2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 146.98 |
| IUPAC Name | 2-[(S)-methylsulfinyl]-1,3-thiazole |
| SMILES | C[S@](=O)c1nccs1 |
| InChI | InChI=1S/C4H5NOS2/c1-8(6)4-5-2-3-7-4/h2-3H,1H3/t8-/m0/s1 |
| InChIKey | RQYMPCMLYRLKMZ-QMMMGPOBSA-N |
| XLogP | 0.88 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |