C32H31NO2 — CID 134969353
tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-naphthalen-1-ylpent-4-enoate (PubChem CID 134969353) has the molecular formula C32H31NO2 and a molecular weight of 461.61 g/mol. Its IUPAC name is tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-naphthalen-1-ylpent-4-enoate.
| Compound Name | tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-naphthalen-1-ylpent-4-enoate |
|---|---|
| PubChem CID | 134969353 |
| Molecular Formula | C32H31NO2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-naphthalen-1-ylpent-4-enoate |
| SMILES | CC(C)(C)OC(=O)[C@H](C/C=C/c1cccc2ccccc12)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H31NO2/c1-32(2,3)35-31(34)29(23-13-21-25-20-12-19-24-14-10-11-22-28(24)25)33-30(26-15-6-4-7-16-26)27-17-8-5-9-18-27/h4-22,29H,23H2,1-3H3/b21-13+/t29-/m0/s1 |
| InChIKey | DGRJQXMWGRAGON-BCMZQPROSA-N |
| XLogP | 7.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|