C28H28FNO2 — CID 134969519
tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-(3-fluorophenyl)pent-4-enoate (PubChem CID 134969519) has the molecular formula C28H28FNO2 and a molecular weight of 429.54 g/mol. Its IUPAC name is tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-(3-fluorophenyl)pent-4-enoate.
| Compound Name | tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-(3-fluorophenyl)pent-4-enoate |
|---|---|
| PubChem CID | 134969519 |
| Molecular Formula | C28H28FNO2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | tert-butyl (E,2S)-2-(benzhydrylideneamino)-5-(3-fluorophenyl)pent-4-enoate |
| SMILES | CC(C)(C)OC(=O)[C@H](C/C=C/c1cccc(F)c1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28FNO2/c1-28(2,3)32-27(31)25(19-11-13-21-12-10-18-24(29)20-21)30-26(22-14-6-4-7-15-22)23-16-8-5-9-17-23/h4-18,20,25H,19H2,1-3H3/b13-11+/t25-/m0/s1 |
| InChIKey | KDDYIDWMINQVTH-BVYAJCBJSA-N |
| XLogP | 6.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|