C46H53NO8 — CID 134969698
(2S,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-[2-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethenyl]pyrrolidine (PubChem CID 134969698) has the molecular formula C46H53NO8 and a molecular weight of 747.93 g/mol. Its IUPAC name is (2S,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-[2-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethenyl]pyrrolidine.
| Compound Name | (2S,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-[2-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethenyl]pyrrolidine |
|---|---|
| PubChem CID | 134969698 |
| Molecular Formula | C46H53NO8 |
| Molecular Weight | 747.93 g/mol |
| Exact Mass | 747.38 |
| IUPAC Name | (2S,5R)-1-benzyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-5-[2-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]ethenyl]pyrrolidine |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(C=C[C@@H]3C(OCc4ccccc4)C(OCc4ccccc4)[C@H](COCc4ccccc4)N3Cc3ccccc3)O[C@@H]2O1 |
| InChI | InChI=1S/C46H53NO8/c1-45(2)52-41-38(51-44-43(42(41)53-45)54-46(3,4)55-44)26-25-36-39(49-29-34-21-13-7-14-22-34)40(50-30-35-23-15-8-16-24-35)37(31-48-28-33-19-11-6-12-20-33)47(36)27-32-17-9-5-10-18-32/h5-26,36-44H,27-31H2,1-4H3/t36-,37+,38?,39?,40?,41+,42?,43?,44-/m1/s1 |
| InChIKey | VNINELCGVBVFNV-ODZWJPGTSA-N |
| XLogP | 7.58 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.93 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|