C37H68O8Si2 — CID 134969816
methyl (E,2R,3S,4S,5R,6S,7R,10S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-[(4-methoxyphenyl)methoxy]-4,6,8,10-tetramethyl-5-triethylsilyloxydodec-8-enoate (PubChem CID 134969816) has the molecular formula C37H68O8Si2 and a molecular weight of 697.12 g/mol. Its IUPAC name is methyl (E,2R,3S,4S,5R,6S,7R,10S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-[(4-methoxyphenyl)methoxy]-4,6,8,10-tetramethyl-5-triethylsilyloxydodec-8-enoate.
| Compound Name | methyl (E,2R,3S,4S,5R,6S,7R,10S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-[(4-methoxyphenyl)methoxy]-4,6,8,10-tetramethyl-5-triethylsilyloxydodec-8-enoate |
|---|---|
| PubChem CID | 134969816 |
| Molecular Formula | C37H68O8Si2 |
| Molecular Weight | 697.12 g/mol |
| Exact Mass | 696.45 |
| IUPAC Name | methyl (E,2R,3S,4S,5R,6S,7R,10S,11S)-7-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-[(4-methoxyphenyl)methoxy]-4,6,8,10-tetramethyl-5-triethylsilyloxydodec-8-enoate |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@H](O)[C@@H](O)C(=O)OC)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)[C@H](C)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C37H68O8Si2/c1-16-47(17-2,18-3)45-35(27(6)32(38)33(39)36(40)42-13)28(7)34(44-46(14,15)37(9,10)11)26(5)23-25(4)29(8)43-24-30-19-21-31(41-12)22-20-30/h19-23,25,27-29,32-35,38-39H,16-18,24H2,1-15H3/b26-23+/t25-,27-,28+,29-,32-,33+,34-,35+/m0/s1 |
| InChIKey | WKKGTTKWJSZOPN-UDYQTHDASA-N |
| XLogP | 8.13 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.12 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|